C21H20N2O2 — CID 2094087
(1'R,2S,5'S)-3-(4-methoxyphenyl)spiro[1H-quinazoline-2,7'-bicyclo[3.2.0]hept-2-ene]-4-one (PubChem CID 2094087) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1'R,2S,5'S)-3-(4-methoxyphenyl)spiro[1H-quinazoline-2,7'-bicyclo[3.2.0]hept-2-ene]-4-one.
| Compound Name | (1'R,2S,5'S)-3-(4-methoxyphenyl)spiro[1H-quinazoline-2,7'-bicyclo[3.2.0]hept-2-ene]-4-one |
|---|---|
| PubChem CID | 2094087 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (1'R,2S,5'S)-3-(4-methoxyphenyl)spiro[1H-quinazoline-2,7'-bicyclo[3.2.0]hept-2-ene]-4-one |
| SMILES | COc1ccc(N2C(=O)c3ccccc3N[C@@]23C[C@@H]2CC=C[C@@H]23)cc1 |
| InChI | InChI=1S/C21H20N2O2/c1-25-16-11-9-15(10-12-16)23-20(24)17-6-2-3-8-19(17)22-21(23)13-14-5-4-7-18(14)21/h2-4,6-12,14,18,22H,5,13H2,1H3/t14-,18-,21-/m0/s1 |
| InChIKey | LCYMPMHYRUSCCD-XQAUZQBESA-N |
| XLogP | 4.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|