C18H16ClN3O2 — CID 20941631
3-[(2-chlorophenyl)methylamino]-1-(4-methoxyphenyl)pyrazin-2-one (PubChem CID 20941631) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]-1-(4-methoxyphenyl)pyrazin-2-one.
| Compound Name | 3-[(2-chlorophenyl)methylamino]-1-(4-methoxyphenyl)pyrazin-2-one |
|---|---|
| PubChem CID | 20941631 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]-1-(4-methoxyphenyl)pyrazin-2-one |
| SMILES | COc1ccc(-n2ccnc(NCc3ccccc3Cl)c2=O)cc1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-24-15-8-6-14(7-9-15)22-11-10-20-17(18(22)23)21-12-13-4-2-3-5-16(13)19/h2-11H,12H2,1H3,(H,20,21) |
| InChIKey | WSQXHTPGKISYNH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |