C19H17N3O4 — CID 46337486
3-(1,3-benzodioxol-5-ylmethylamino)-1-(4-methoxyphenyl)pyrazin-2-one (PubChem CID 46337486) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-1-(4-methoxyphenyl)pyrazin-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-1-(4-methoxyphenyl)pyrazin-2-one |
|---|---|
| PubChem CID | 46337486 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-1-(4-methoxyphenyl)pyrazin-2-one |
| SMILES | COc1ccc(-n2ccnc(NCc3ccc4c(c3)OCO4)c2=O)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-24-15-5-3-14(4-6-15)22-9-8-20-18(19(22)23)21-11-13-2-7-16-17(10-13)26-12-25-16/h2-10H,11-12H2,1H3,(H,20,21) |
| InChIKey | PNYGJCZHAHZFPH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |