C20H17N3O5 — CID 53118441
N-[4-(4-ethoxyphenyl)-3-oxopyrazin-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 53118441) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-3-oxopyrazin-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-3-oxopyrazin-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 53118441 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-3-oxopyrazin-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOc1ccc(-n2ccnc(NC(=O)c3ccc4c(c3)OCO4)c2=O)cc1 |
| InChI | InChI=1S/C20H17N3O5/c1-2-26-15-6-4-14(5-7-15)23-10-9-21-18(20(23)25)22-19(24)13-3-8-16-17(11-13)28-12-27-16/h3-11H,2,12H2,1H3,(H,21,22,24) |
| InChIKey | KLNIPIUXEPJIKJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |