C22H25N3O — CID 20941702
3-(3-phenylpropylamino)-1-(4-propan-2-ylphenyl)pyrazin-2-one (PubChem CID 20941702) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(3-phenylpropylamino)-1-(4-propan-2-ylphenyl)pyrazin-2-one.
| Compound Name | 3-(3-phenylpropylamino)-1-(4-propan-2-ylphenyl)pyrazin-2-one |
|---|---|
| PubChem CID | 20941702 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-(3-phenylpropylamino)-1-(4-propan-2-ylphenyl)pyrazin-2-one |
| SMILES | CC(C)c1ccc(-n2ccnc(NCCCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-17(2)19-10-12-20(13-11-19)25-16-15-24-21(22(25)26)23-14-6-9-18-7-4-3-5-8-18/h3-5,7-8,10-13,15-17H,6,9,14H2,1-2H3,(H,23,24) |
| InChIKey | LZXNLAOIFVUUPP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|