C29H32FN5O2 — CID 20944467
N-[(2-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine (PubChem CID 20944467) has the molecular formula C29H32FN5O2 and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[(2-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine.
| Compound Name | N-[(2-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 20944467 |
| Molecular Formula | C29H32FN5O2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | N-[(2-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine |
| SMILES | COc1ccccc1N1CCN(CCCNC(c2nnc(-c3ccccc3)o2)c2ccccc2F)CC1 |
| InChI | InChI=1S/C29H32FN5O2/c1-36-26-15-8-7-14-25(26)35-20-18-34(19-21-35)17-9-16-31-27(23-12-5-6-13-24(23)30)29-33-32-28(37-29)22-10-3-2-4-11-22/h2-8,10-15,27,31H,9,16-21H2,1H3 |
| InChIKey | ALHKMPHIIXLELX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|