C28H30FN5O — CID 92707771
N-[(R)-(4-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4-phenylpiperazin-1-yl)propan-1-amine (PubChem CID 92707771) has the molecular formula C28H30FN5O and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[(R)-(4-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4-phenylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[(R)-(4-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4-phenylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 92707771 |
| Molecular Formula | C28H30FN5O |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[(R)-(4-fluorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4-phenylpiperazin-1-yl)propan-1-amine |
| SMILES | Fc1ccc([C@@H](NCCCN2CCN(c3ccccc3)CC2)c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C28H30FN5O/c29-24-14-12-22(13-15-24)26(28-32-31-27(35-28)23-8-3-1-4-9-23)30-16-7-17-33-18-20-34(21-19-33)25-10-5-2-6-11-25/h1-6,8-15,26,30H,7,16-21H2/t26-/m1/s1 |
| InChIKey | VAEJUFOBCVDPSS-AREMUKBSSA-N |
| XLogP | 4.77 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|