C20H20N2O4S2 — CID 20944550
methyl 3-[[4-(dimethylamino)phenyl]sulfamoyl]-4-phenylthiophene-2-carboxylate (PubChem CID 20944550) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl 3-[[4-(dimethylamino)phenyl]sulfamoyl]-4-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[[4-(dimethylamino)phenyl]sulfamoyl]-4-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 20944550 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | methyl 3-[[4-(dimethylamino)phenyl]sulfamoyl]-4-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(-c2ccccc2)c1S(=O)(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-22(2)16-11-9-15(10-12-16)21-28(24,25)19-17(14-7-5-4-6-8-14)13-27-18(19)20(23)26-3/h4-13,21H,1-3H3 |
| InChIKey | JVNNARZTSJGAPK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|