C22H23NO4S2 — CID 16832177
methyl 4-(4-methylphenyl)-3-[(4-propan-2-ylphenyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 16832177) has the molecular formula C22H23NO4S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-3-[(4-propan-2-ylphenyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-(4-methylphenyl)-3-[(4-propan-2-ylphenyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 16832177 |
| Molecular Formula | C22H23NO4S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | methyl 4-(4-methylphenyl)-3-[(4-propan-2-ylphenyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(-c2ccc(C)cc2)c1S(=O)(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H23NO4S2/c1-14(2)16-9-11-18(12-10-16)23-29(25,26)21-19(13-28-20(21)22(24)27-4)17-7-5-15(3)6-8-17/h5-14,23H,1-4H3 |
| InChIKey | QQRLQZXZRPHZRQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |