C22H22N2O3S — CID 20946133
7-(2,3-dihydroindol-1-ylsulfonyl)-6-ethyl-1,2,3,9-tetrahydrocarbazol-4-one (PubChem CID 20946133) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 7-(2,3-dihydroindol-1-ylsulfonyl)-6-ethyl-1,2,3,9-tetrahydrocarbazol-4-one.
| Compound Name | 7-(2,3-dihydroindol-1-ylsulfonyl)-6-ethyl-1,2,3,9-tetrahydrocarbazol-4-one |
|---|---|
| PubChem CID | 20946133 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 7-(2,3-dihydroindol-1-ylsulfonyl)-6-ethyl-1,2,3,9-tetrahydrocarbazol-4-one |
| SMILES | CCc1cc2c3c([nH]c2cc1S(=O)(=O)N1CCc2ccccc21)CCCC3=O |
| InChI | InChI=1S/C22H22N2O3S/c1-2-14-12-16-18(23-17-7-5-9-20(25)22(16)17)13-21(14)28(26,27)24-11-10-15-6-3-4-8-19(15)24/h3-4,6,8,12-13,23H,2,5,7,9-11H2,1H3 |
| InChIKey | OREIODNJWYSTQB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |