C23H22N4O3 — CID 20946798
N-[3-(furan-2-yl)propyl]-2-methyl-5-oxo-6-(pyridin-3-ylmethyl)-1,6-naphthyridine-3-carboxamide (PubChem CID 20946798) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propyl]-2-methyl-5-oxo-6-(pyridin-3-ylmethyl)-1,6-naphthyridine-3-carboxamide.
| Compound Name | N-[3-(furan-2-yl)propyl]-2-methyl-5-oxo-6-(pyridin-3-ylmethyl)-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 20946798 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[3-(furan-2-yl)propyl]-2-methyl-5-oxo-6-(pyridin-3-ylmethyl)-1,6-naphthyridine-3-carboxamide |
| SMILES | Cc1nc2ccn(Cc3cccnc3)c(=O)c2cc1C(=O)NCCCc1ccco1 |
| InChI | InChI=1S/C23H22N4O3/c1-16-19(22(28)25-10-3-6-18-7-4-12-30-18)13-20-21(26-16)8-11-27(23(20)29)15-17-5-2-9-24-14-17/h2,4-5,7-9,11-14H,3,6,10,15H2,1H3,(H,25,28) |
| InChIKey | OKBXTUJCOVLMNU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|