C24H23N3O3 — CID 20946822
6-(furan-2-ylmethyl)-2-methyl-5-oxo-N-(3-phenylpropyl)-1,6-naphthyridine-3-carboxamide (PubChem CID 20946822) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 6-(furan-2-ylmethyl)-2-methyl-5-oxo-N-(3-phenylpropyl)-1,6-naphthyridine-3-carboxamide.
| Compound Name | 6-(furan-2-ylmethyl)-2-methyl-5-oxo-N-(3-phenylpropyl)-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 20946822 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 6-(furan-2-ylmethyl)-2-methyl-5-oxo-N-(3-phenylpropyl)-1,6-naphthyridine-3-carboxamide |
| SMILES | Cc1nc2ccn(Cc3ccco3)c(=O)c2cc1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c1-17-20(23(28)25-12-5-9-18-7-3-2-4-8-18)15-21-22(26-17)11-13-27(24(21)29)16-19-10-6-14-30-19/h2-4,6-8,10-11,13-15H,5,9,12,16H2,1H3,(H,25,28) |
| InChIKey | BMIACZRPMGADMR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|