C20H27N3OS — CID 20948109
7-ethyl-N-propan-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 20948109) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 7-ethyl-N-propan-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-ethyl-N-propan-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 20948109 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 7-ethyl-N-propan-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCC1c2cccn2-c2sc3c(c2CN1C(=O)NC(C)C)CCCC3 |
| InChI | InChI=1S/C20H27N3OS/c1-4-16-17-9-7-11-22(17)19-15(12-23(16)20(24)21-13(2)3)14-8-5-6-10-18(14)25-19/h7,9,11,13,16H,4-6,8,10,12H2,1-3H3,(H,21,24) |
| InChIKey | HBWIKPIIPZLASF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |