C24H26N2OS — CID 92880364
2-methyl-1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]propan-1-one (PubChem CID 92880364) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-methyl-1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]propan-1-one.
| Compound Name | 2-methyl-1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]propan-1-one |
|---|---|
| PubChem CID | 92880364 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-methyl-1-[(7R)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraen-8-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H26N2OS/c1-16(2)23(27)26-15-19-18-11-6-7-13-21(18)28-24(19)25-14-8-12-20(25)22(26)17-9-4-3-5-10-17/h3-5,8-10,12,14,16,22H,6-7,11,13,15H2,1-2H3/t22-/m1/s1 |
| InChIKey | ILJFYDKSJWLSSL-JOCHJYFZSA-N |
| XLogP | 5.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |