C27H24BrN3OS — CID 92749621
(7S)-N-(4-bromophenyl)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92749621) has the molecular formula C27H24BrN3OS and a molecular weight of 518.48 g/mol. Its IUPAC name is (7S)-N-(4-bromophenyl)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-N-(4-bromophenyl)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92749621 |
| Molecular Formula | C27H24BrN3OS |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (7S)-N-(4-bromophenyl)-7-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H24BrN3OS/c28-19-12-14-20(15-13-19)29-27(32)31-17-22-21-9-4-5-11-24(21)33-26(22)30-16-6-10-23(30)25(31)18-7-2-1-3-8-18/h1-3,6-8,10,12-16,25H,4-5,9,11,17H2,(H,29,32)/t25-/m0/s1 |
| InChIKey | LCADMSUQWFTKKJ-VWLOTQADSA-N |
| XLogP | 7.32 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |