C29H29N3OS — CID 92724704
(7R)-N-(3-methylphenyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92724704) has the molecular formula C29H29N3OS and a molecular weight of 467.64 g/mol. Its IUPAC name is (7R)-N-(3-methylphenyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-N-(3-methylphenyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92724704 |
| Molecular Formula | C29H29N3OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (7R)-N-(3-methylphenyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccc([C@@H]2c3cccn3-c3sc4c(c3CN2C(=O)Nc2cccc(C)c2)CCCC4)cc1 |
| InChI | InChI=1S/C29H29N3OS/c1-19-12-14-21(15-13-19)27-25-10-6-16-31(25)28-24(23-9-3-4-11-26(23)34-28)18-32(27)29(33)30-22-8-5-7-20(2)17-22/h5-8,10,12-17,27H,3-4,9,11,18H2,1-2H3,(H,30,33)/t27-/m1/s1 |
| InChIKey | SRJKTCODXWOGED-HHHXNRCGSA-N |
| XLogP | 7.17 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |