C26H25N3OS2 — CID 46340707
N-(3-methylphenyl)-7-thiophen-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340707) has the molecular formula C26H25N3OS2 and a molecular weight of 459.64 g/mol. Its IUPAC name is N-(3-methylphenyl)-7-thiophen-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | N-(3-methylphenyl)-7-thiophen-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340707 |
| Molecular Formula | C26H25N3OS2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-(3-methylphenyl)-7-thiophen-2-yl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3C2c2cccs2)c1 |
| InChI | InChI=1S/C26H25N3OS2/c1-17-7-4-8-18(15-17)27-26(30)29-16-20-19-9-2-3-11-22(19)32-25(20)28-13-5-10-21(28)24(29)23-12-6-14-31-23/h4-8,10,12-15,24H,2-3,9,11,16H2,1H3,(H,27,30) |
| InChIKey | VGZRGHGZVXIGPZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |