C26H22F3N3OS2 — CID 92873395
(7R)-7-thiophen-2-yl-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873395) has the molecular formula C26H22F3N3OS2 and a molecular weight of 513.61 g/mol. Its IUPAC name is (7R)-7-thiophen-2-yl-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-thiophen-2-yl-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873395 |
| Molecular Formula | C26H22F3N3OS2 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (7R)-7-thiophen-2-yl-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C26H22F3N3OS2/c27-26(28,29)18-8-2-3-9-19(18)30-25(33)32-15-17-16-7-1-4-11-21(16)35-24(17)31-13-5-10-20(31)23(32)22-12-6-14-34-22/h2-3,5-6,8-10,12-14,23H,1,4,7,11,15H2,(H,30,33)/t23-/m1/s1 |
| InChIKey | LVHADZWXIWQTKA-HSZRJFAPSA-N |
| XLogP | 7.64 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |