C29H26F3N3O2S — CID 46340485
7-(4-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340485) has the molecular formula C29H26F3N3O2S and a molecular weight of 537.61 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(4-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340485 |
| Molecular Formula | C29H26F3N3O2S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 7-(4-methoxyphenyl)-N-[2-(trifluoromethyl)phenyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)Nc2ccccc2C(F)(F)F)CCCC4)cc1 |
| InChI | InChI=1S/C29H26F3N3O2S/c1-37-19-14-12-18(13-15-19)26-24-10-6-16-34(24)27-21(20-7-2-5-11-25(20)38-27)17-35(26)28(36)33-23-9-4-3-8-22(23)29(30,31)32/h3-4,6,8-10,12-16,26H,2,5,7,11,17H2,1H3,(H,33,36) |
| InChIKey | JTFWLIRGZSKSNB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |