C31H31N3O3S — CID 92724701
ethyl 4-[[(7S)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate (PubChem CID 92724701) has the molecular formula C31H31N3O3S and a molecular weight of 525.67 g/mol. Its IUPAC name is ethyl 4-[[(7S)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(7S)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 92724701 |
| Molecular Formula | C31H31N3O3S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | ethyl 4-[[(7S)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H31N3O3S/c1-3-37-30(35)22-14-16-23(17-15-22)32-31(36)34-19-25-24-7-4-5-9-27(24)38-29(25)33-18-6-8-26(33)28(34)21-12-10-20(2)11-13-21/h6,8,10-18,28H,3-5,7,9,19H2,1-2H3,(H,32,36)/t28-/m0/s1 |
| InChIKey | BCOUKTLUKDFBCR-NDEPHWFRSA-N |
| XLogP | 7.04 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |