C30H31N3O2S — CID 92749764
(7R)-7-(3-ethoxyphenyl)-N-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92749764) has the molecular formula C30H31N3O2S and a molecular weight of 497.66 g/mol. Its IUPAC name is (7R)-7-(3-ethoxyphenyl)-N-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-(3-ethoxyphenyl)-N-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92749764 |
| Molecular Formula | C30H31N3O2S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (7R)-7-(3-ethoxyphenyl)-N-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCOc1cccc([C@@H]2c3cccn3-c3sc4c(c3CN2C(=O)Nc2ccc(C)cc2)CCCC4)c1 |
| InChI | InChI=1S/C30H31N3O2S/c1-3-35-23-9-6-8-21(18-23)28-26-11-7-17-32(26)29-25(24-10-4-5-12-27(24)36-29)19-33(28)30(34)31-22-15-13-20(2)14-16-22/h6-9,11,13-18,28H,3-5,10,12,19H2,1-2H3,(H,31,34)/t28-/m1/s1 |
| InChIKey | VQDDGVMRXNLPAP-MUUNZHRXSA-N |
| XLogP | 7.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |