C29H28ClN3O2S — CID 92873319
(7S)-7-(3-chlorophenyl)-N-(4-ethoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873319) has the molecular formula C29H28ClN3O2S and a molecular weight of 518.08 g/mol. Its IUPAC name is (7S)-7-(3-chlorophenyl)-N-(4-ethoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-(3-chlorophenyl)-N-(4-ethoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873319 |
| Molecular Formula | C29H28ClN3O2S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (7S)-7-(3-chlorophenyl)-N-(4-ethoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@@H]2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C29H28ClN3O2S/c1-2-35-22-14-12-21(13-15-22)31-29(34)33-18-24-23-9-3-4-11-26(23)36-28(24)32-16-6-10-25(32)27(33)19-7-5-8-20(30)17-19/h5-8,10,12-17,27H,2-4,9,11,18H2,1H3,(H,31,34)/t27-/m0/s1 |
| InChIKey | BWESLXHWFNGVKT-MHZLTWQESA-N |
| XLogP | 7.61 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |