C27H24ClN3OS — CID 92873311
(7S)-7-(3-chlorophenyl)-N-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873311) has the molecular formula C27H24ClN3OS and a molecular weight of 474.03 g/mol. Its IUPAC name is (7S)-7-(3-chlorophenyl)-N-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-(3-chlorophenyl)-N-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873311 |
| Molecular Formula | C27H24ClN3OS |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (7S)-7-(3-chlorophenyl)-N-phenyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H24ClN3OS/c28-19-9-6-8-18(16-19)25-23-13-7-15-30(23)26-22(21-12-4-5-14-24(21)33-26)17-31(25)27(32)29-20-10-2-1-3-11-20/h1-3,6-11,13,15-16,25H,4-5,12,14,17H2,(H,29,32)/t25-/m0/s1 |
| InChIKey | VNPHLYSPNJZVRJ-VWLOTQADSA-N |
| XLogP | 7.21 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |