C26H28ClN3OS — CID 92873323
(7S)-7-(3-chlorophenyl)-N-cyclopentyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873323) has the molecular formula C26H28ClN3OS and a molecular weight of 466.05 g/mol. Its IUPAC name is (7S)-7-(3-chlorophenyl)-N-cyclopentyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-(3-chlorophenyl)-N-cyclopentyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873323 |
| Molecular Formula | C26H28ClN3OS |
| Molecular Weight | 466.05 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (7S)-7-(3-chlorophenyl)-N-cyclopentyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(NC1CCCC1)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H28ClN3OS/c27-18-8-5-7-17(15-18)24-22-12-6-14-29(22)25-21(20-11-3-4-13-23(20)32-25)16-30(24)26(31)28-19-9-1-2-10-19/h5-8,12,14-15,19,24H,1-4,9-11,13,16H2,(H,28,31)/t24-/m0/s1 |
| InChIKey | NYWLHLDSAKRENZ-DEOSSOPVSA-N |
| XLogP | 6.63 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.05 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |