C27H23ClFN3OS — CID 92749696
(7R)-N-(3-chlorophenyl)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92749696) has the molecular formula C27H23ClFN3OS and a molecular weight of 492.02 g/mol. Its IUPAC name is (7R)-N-(3-chlorophenyl)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-N-(3-chlorophenyl)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92749696 |
| Molecular Formula | C27H23ClFN3OS |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (7R)-N-(3-chlorophenyl)-7-(3-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C27H23ClFN3OS/c28-18-7-4-9-20(15-18)30-27(33)32-16-22-21-10-1-2-12-24(21)34-26(22)31-13-5-11-23(31)25(32)17-6-3-8-19(29)14-17/h3-9,11,13-15,25H,1-2,10,12,16H2,(H,30,33)/t25-/m1/s1 |
| InChIKey | OLNGOTHXFCPMQG-RUZDIDTESA-N |
| XLogP | 7.35 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |