C28H26ClN3OS — CID 92873315
(7S)-7-(3-chlorophenyl)-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873315) has the molecular formula C28H26ClN3OS and a molecular weight of 488.06 g/mol. Its IUPAC name is (7S)-7-(3-chlorophenyl)-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-(3-chlorophenyl)-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873315 |
| Molecular Formula | C28H26ClN3OS |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (7S)-7-(3-chlorophenyl)-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H26ClN3OS/c1-18-8-2-4-12-23(18)30-28(33)32-17-22-21-11-3-5-14-25(21)34-27(22)31-15-7-13-24(31)26(32)19-9-6-10-20(29)16-19/h2,4,6-10,12-13,15-16,26H,3,5,11,14,17H2,1H3,(H,30,33)/t26-/m0/s1 |
| InChIKey | DJPDCHGFEXVPAV-SANMLTNESA-N |
| XLogP | 7.52 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |