C30H28ClN3O3S — CID 20948079
methyl 4-chloro-2-[[7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate (PubChem CID 20948079) has the molecular formula C30H28ClN3O3S and a molecular weight of 546.09 g/mol. Its IUPAC name is methyl 4-chloro-2-[[7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-2-[[7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 20948079 |
| Molecular Formula | C30H28ClN3O3S |
| Molecular Weight | 546.09 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | methyl 4-chloro-2-[[7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NC(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2C1c1cccc(C)c1 |
| InChI | InChI=1S/C30H28ClN3O3S/c1-18-7-5-8-19(15-18)27-25-10-6-14-33(25)28-23(21-9-3-4-11-26(21)38-28)17-34(27)30(36)32-24-16-20(31)12-13-22(24)29(35)37-2/h5-8,10,12-16,27H,3-4,9,11,17H2,1-2H3,(H,32,36) |
| InChIKey | XLSDGRKGDOWWGL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.09 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |