C30H30ClN3O3S — CID 20948076
N-(5-chloro-2,4-dimethoxyphenyl)-7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 20948076) has the molecular formula C30H30ClN3O3S and a molecular weight of 548.11 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 20948076 |
| Molecular Formula | C30H30ClN3O3S |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-7-(3-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3C2c2cccc(C)c2)cc1Cl |
| InChI | InChI=1S/C30H30ClN3O3S/c1-18-8-6-9-19(14-18)28-24-11-7-13-33(24)29-21(20-10-4-5-12-27(20)38-29)17-34(28)30(35)32-23-15-22(31)25(36-2)16-26(23)37-3/h6-9,11,13-16,28H,4-5,10,12,17H2,1-3H3,(H,32,35) |
| InChIKey | CKPNTPHXRRQCQK-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |