C24H26ClN3O3S — CID 92873552
(7R)-N-(5-chloro-2,4-dimethoxyphenyl)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873552) has the molecular formula C24H26ClN3O3S and a molecular weight of 472.01 g/mol. Its IUPAC name is (7R)-N-(5-chloro-2,4-dimethoxyphenyl)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-N-(5-chloro-2,4-dimethoxyphenyl)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873552 |
| Molecular Formula | C24H26ClN3O3S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (7R)-N-(5-chloro-2,4-dimethoxyphenyl)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@H]2C)cc1Cl |
| InChI | InChI=1S/C24H26ClN3O3S/c1-14-19-8-6-10-27(19)23-16(15-7-4-5-9-22(15)32-23)13-28(14)24(29)26-18-11-17(25)20(30-2)12-21(18)31-3/h6,8,10-12,14H,4-5,7,9,13H2,1-3H3,(H,26,29)/t14-/m1/s1 |
| InChIKey | CCODSUHJANXXNJ-CQSZACIVSA-N |
| XLogP | 6.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |