C23H25N3OS — CID 46340799
7-methyl-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340799) has the molecular formula C23H25N3OS and a molecular weight of 391.54 g/mol. Its IUPAC name is 7-methyl-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-methyl-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340799 |
| Molecular Formula | C23H25N3OS |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 7-methyl-N-(2-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2C1C |
| InChI | InChI=1S/C23H25N3OS/c1-15-8-3-5-10-19(15)24-23(27)26-14-18-17-9-4-6-12-21(17)28-22(18)25-13-7-11-20(25)16(26)2/h3,5,7-8,10-11,13,16H,4,6,9,12,14H2,1-2H3,(H,24,27) |
| InChIKey | KWCBCLJZIAHAFF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |