C24H25N3O3S — CID 92873581
methyl 3-[[(7S)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate (PubChem CID 92873581) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is methyl 3-[[(7S)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[(7S)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 92873581 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | methyl 3-[[(7S)-7-methyl-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@@H]2C)c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-15-20-10-6-12-26(20)22-19(18-9-3-4-11-21(18)31-22)14-27(15)24(29)25-17-8-5-7-16(13-17)23(28)30-2/h5-8,10,12-13,15H,3-4,9,11,14H2,1-2H3,(H,25,29)/t15-/m0/s1 |
| InChIKey | PBRSTGHPECXIPU-HNNXBMFYSA-N |
| XLogP | 5.31 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |