C22H23ClN4OS — CID 92891736
(7R)-N-(2-chlorophenyl)-7,14-dimethyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92891736) has the molecular formula C22H23ClN4OS and a molecular weight of 426.97 g/mol. Its IUPAC name is (7R)-N-(2-chlorophenyl)-7,14-dimethyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-N-(2-chlorophenyl)-7,14-dimethyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92891736 |
| Molecular Formula | C22H23ClN4OS |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (7R)-N-(2-chlorophenyl)-7,14-dimethyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | C[C@@H]1c2cccn2-c2sc3c(c2CN1C(=O)Nc1ccccc1Cl)CCN(C)C3 |
| InChI | InChI=1S/C22H23ClN4OS/c1-14-19-8-5-10-26(19)21-16(15-9-11-25(2)13-20(15)29-21)12-27(14)22(28)24-18-7-4-3-6-17(18)23/h3-8,10,14H,9,11-13H2,1-2H3,(H,24,28)/t14-/m1/s1 |
| InChIKey | HZGQATGEJOWOHY-CQSZACIVSA-N |
| XLogP | 5.29 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |