C29H29ClN4OS — CID 93058724
(7R)-7-(3-chlorophenyl)-N-(2-ethylphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 93058724) has the molecular formula C29H29ClN4OS and a molecular weight of 517.10 g/mol. Its IUPAC name is (7R)-7-(3-chlorophenyl)-N-(2-ethylphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-(3-chlorophenyl)-N-(2-ethylphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 93058724 |
| Molecular Formula | C29H29ClN4OS |
| Molecular Weight | 517.10 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | (7R)-7-(3-chlorophenyl)-N-(2-ethylphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCc1ccccc1NC(=O)N1Cc2c(sc3c2CCN(C)C3)-n2cccc2[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H29ClN4OS/c1-3-19-8-4-5-11-24(19)31-29(35)34-17-23-22-13-15-32(2)18-26(22)36-28(23)33-14-7-12-25(33)27(34)20-9-6-10-21(30)16-20/h4-12,14,16,27H,3,13,15,17-18H2,1-2H3,(H,31,35)/t27-/m1/s1 |
| InChIKey | GGMUDSBYBDJXBH-HHHXNRCGSA-N |
| XLogP | 6.88 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.10 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |