C27H25ClN4OS — CID 93058537
(7S)-7-(4-chlorophenyl)-14-methyl-N-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 93058537) has the molecular formula C27H25ClN4OS and a molecular weight of 489.04 g/mol. Its IUPAC name is (7S)-7-(4-chlorophenyl)-14-methyl-N-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-7-(4-chlorophenyl)-14-methyl-N-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 93058537 |
| Molecular Formula | C27H25ClN4OS |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (7S)-7-(4-chlorophenyl)-14-methyl-N-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CN1CCc2c(sc3c2CN(C(=O)Nc2ccccc2)[C@@H](c2ccc(Cl)cc2)c2cccn2-3)C1 |
| InChI | InChI=1S/C27H25ClN4OS/c1-30-15-13-21-22-16-32(27(33)29-20-6-3-2-4-7-20)25(18-9-11-19(28)12-10-18)23-8-5-14-31(23)26(22)34-24(21)17-30/h2-12,14,25H,13,15-17H2,1H3,(H,29,33)/t25-/m0/s1 |
| InChIKey | LQLZEZQQHFGNTL-VWLOTQADSA-N |
| XLogP | 6.32 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |