C30H29ClN4O3S — CID 92906593
ethyl 3-[[(7R)-7-(4-chlorophenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate (PubChem CID 92906593) has the molecular formula C30H29ClN4O3S and a molecular weight of 561.11 g/mol. Its IUPAC name is ethyl 3-[[(7R)-7-(4-chlorophenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[(7R)-7-(4-chlorophenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 92906593 |
| Molecular Formula | C30H29ClN4O3S |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | ethyl 3-[[(7R)-7-(4-chlorophenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)N2Cc3c(sc4c3CCN(C)C4)-n3cccc3[C@H]2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C30H29ClN4O3S/c1-3-38-29(36)20-6-4-7-22(16-20)32-30(37)35-17-24-23-13-15-33(2)18-26(23)39-28(24)34-14-5-8-25(34)27(35)19-9-11-21(31)12-10-19/h4-12,14,16,27H,3,13,15,17-18H2,1-2H3,(H,32,37)/t27-/m1/s1 |
| InChIKey | CIPFWMDWYHBFSF-HHHXNRCGSA-N |
| XLogP | 6.49 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |