C28H27FN4O2S — CID 53028865
7-(4-fluorophenyl)-N-(3-methoxyphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 53028865) has the molecular formula C28H27FN4O2S and a molecular weight of 502.62 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-N-(3-methoxyphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(4-fluorophenyl)-N-(3-methoxyphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 53028865 |
| Molecular Formula | C28H27FN4O2S |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 7-(4-fluorophenyl)-N-(3-methoxyphenyl)-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1cccc(NC(=O)N2Cc3c(sc4c3CCN(C)C4)-n3cccc3C2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C28H27FN4O2S/c1-31-14-12-22-23-16-33(28(34)30-20-5-3-6-21(15-20)35-2)26(18-8-10-19(29)11-9-18)24-7-4-13-32(24)27(23)36-25(22)17-31/h3-11,13,15,26H,12,14,16-17H2,1-2H3,(H,30,34) |
| InChIKey | WENXXHBFLXCYBR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |