C26H30N4O3S — CID 92749824
ethyl 2-[[(7S)-7-ethyl-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate (PubChem CID 92749824) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is ethyl 2-[[(7S)-7-ethyl-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[(7S)-7-ethyl-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 92749824 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | ethyl 2-[[(7S)-7-ethyl-14-methyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1Cc2c(sc3c2CCN(C)C3)-n2cccc2[C@@H]1CC |
| InChI | InChI=1S/C26H30N4O3S/c1-4-21-22-11-8-13-29(22)24-19(17-12-14-28(3)16-23(17)34-24)15-30(21)26(32)27-20-10-7-6-9-18(20)25(31)33-5-2/h6-11,13,21H,4-5,12,14-16H2,1-3H3,(H,27,32)/t21-/m0/s1 |
| InChIKey | RRWZBTHRRDPQRF-NRFANRHFSA-N |
| XLogP | 5.20 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |