C31H31N3O4S — CID 46340598
ethyl 2-[[7-(3-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate (PubChem CID 46340598) has the molecular formula C31H31N3O4S and a molecular weight of 541.67 g/mol. Its IUPAC name is ethyl 2-[[7-(3-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[7-(3-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 46340598 |
| Molecular Formula | C31H31N3O4S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | ethyl 2-[[7-(3-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1Cc2c(sc3c2CCCC3)-n2cccc2C1c1cccc(OC)c1 |
| InChI | InChI=1S/C31H31N3O4S/c1-3-38-30(35)23-13-4-6-14-25(23)32-31(36)34-19-24-22-12-5-7-16-27(22)39-29(24)33-17-9-15-26(33)28(34)20-10-8-11-21(18-20)37-2/h4,6,8-11,13-15,17-18,28H,3,5,7,12,16,19H2,1-2H3,(H,32,36) |
| InChIKey | MHBFRMWIFSJDSU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |