C31H33N3O3S — CID 92724602
(7R)-7-(4-ethoxyphenyl)-N-(2-methoxy-5-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92724602) has the molecular formula C31H33N3O3S and a molecular weight of 527.69 g/mol. Its IUPAC name is (7R)-7-(4-ethoxyphenyl)-N-(2-methoxy-5-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-(4-ethoxyphenyl)-N-(2-methoxy-5-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92724602 |
| Molecular Formula | C31H33N3O3S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (7R)-7-(4-ethoxyphenyl)-N-(2-methoxy-5-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCOc1ccc([C@@H]2c3cccn3-c3sc4c(c3CN2C(=O)Nc2cc(C)ccc2OC)CCCC4)cc1 |
| InChI | InChI=1S/C31H33N3O3S/c1-4-37-22-14-12-21(13-15-22)29-26-9-7-17-33(26)30-24(23-8-5-6-10-28(23)38-30)19-34(29)31(35)32-25-18-20(2)11-16-27(25)36-3/h7,9,11-18,29H,4-6,8,10,19H2,1-3H3,(H,32,35)/t29-/m1/s1 |
| InChIKey | FEDMKOLFJZGAQR-GDLZYMKVSA-N |
| XLogP | 7.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |