C29H28ClN3OS — CID 92873328
(7R)-7-(3-chlorophenyl)-N-(2-phenylethyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873328) has the molecular formula C29H28ClN3OS and a molecular weight of 502.08 g/mol. Its IUPAC name is (7R)-7-(3-chlorophenyl)-N-(2-phenylethyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-(3-chlorophenyl)-N-(2-phenylethyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873328 |
| Molecular Formula | C29H28ClN3OS |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | (7R)-7-(3-chlorophenyl)-N-(2-phenylethyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(NCCc1ccccc1)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H28ClN3OS/c30-22-11-6-10-21(18-22)27-25-13-7-17-32(25)28-24(23-12-4-5-14-26(23)35-28)19-33(27)29(34)31-16-15-20-8-2-1-3-9-20/h1-3,6-11,13,17-18,27H,4-5,12,14-16,19H2,(H,31,34)/t27-/m1/s1 |
| InChIKey | GOXJQIRFTJZLOH-HHHXNRCGSA-N |
| XLogP | 6.93 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |