C30H31N3OS — CID 20948084
7-(3-methylphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 20948084) has the molecular formula C30H31N3OS and a molecular weight of 481.67 g/mol. Its IUPAC name is 7-(3-methylphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(3-methylphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 20948084 |
| Molecular Formula | C30H31N3OS |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 7-(3-methylphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccc(CNC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3C2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C30H31N3OS/c1-20-12-14-22(15-13-20)18-31-30(34)33-19-25-24-9-3-4-11-27(24)35-29(25)32-16-6-10-26(32)28(33)23-8-5-7-21(2)17-23/h5-8,10,12-17,28H,3-4,9,11,18-19H2,1-2H3,(H,31,34) |
| InChIKey | AJUBMQMWRIULMR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |