C27H27N3O2S — CID 46340456
N-(furan-2-ylmethyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340456) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340456 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-7-(4-methylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)NCc2ccco2)CCCC4)cc1 |
| InChI | InChI=1S/C27H27N3O2S/c1-18-10-12-19(13-11-18)25-23-8-4-14-29(23)26-22(21-7-2-3-9-24(21)33-26)17-30(25)27(31)28-16-20-6-5-15-32-20/h4-6,8,10-15,25H,2-3,7,9,16-17H2,1H3,(H,28,31) |
| InChIKey | NKVKAJMXKRIINK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |