C29H28FN3O2S — CID 92749665
(7S)-N-[(4-fluorophenyl)methyl]-7-(4-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92749665) has the molecular formula C29H28FN3O2S and a molecular weight of 501.63 g/mol. Its IUPAC name is (7S)-N-[(4-fluorophenyl)methyl]-7-(4-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-N-[(4-fluorophenyl)methyl]-7-(4-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92749665 |
| Molecular Formula | C29H28FN3O2S |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (7S)-N-[(4-fluorophenyl)methyl]-7-(4-methoxyphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | COc1ccc([C@H]2c3cccn3-c3sc4c(c3CN2C(=O)NCc2ccc(F)cc2)CCCC4)cc1 |
| InChI | InChI=1S/C29H28FN3O2S/c1-35-22-14-10-20(11-15-22)27-25-6-4-16-32(25)28-24(23-5-2-3-7-26(23)36-28)18-33(27)29(34)31-17-19-8-12-21(30)13-9-19/h4,6,8-16,27H,2-3,5,7,17-18H2,1H3,(H,31,34)/t27-/m0/s1 |
| InChIKey | VOBGCGWZBLCKRB-MHZLTWQESA-N |
| XLogP | 6.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |