C30H30FN3O2S — CID 46340312
7-(4-ethoxyphenyl)-N-[(4-fluorophenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340312) has the molecular formula C30H30FN3O2S and a molecular weight of 515.65 g/mol. Its IUPAC name is 7-(4-ethoxyphenyl)-N-[(4-fluorophenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(4-ethoxyphenyl)-N-[(4-fluorophenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340312 |
| Molecular Formula | C30H30FN3O2S |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 7-(4-ethoxyphenyl)-N-[(4-fluorophenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCOc1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)NCc2ccc(F)cc2)CCCC4)cc1 |
| InChI | InChI=1S/C30H30FN3O2S/c1-2-36-23-15-11-21(12-16-23)28-26-7-5-17-33(26)29-25(24-6-3-4-8-27(24)37-29)19-34(28)30(35)32-18-20-9-13-22(31)14-10-20/h5,7,9-17,28H,2-4,6,8,18-19H2,1H3,(H,32,35) |
| InChIKey | JHZYOJBIYWGJJS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |