C31H33N3O2S — CID 46340653
7-(3-ethoxyphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340653) has the molecular formula C31H33N3O2S and a molecular weight of 511.69 g/mol. Its IUPAC name is 7-(3-ethoxyphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(3-ethoxyphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340653 |
| Molecular Formula | C31H33N3O2S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 7-(3-ethoxyphenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCOc1cccc(C2c3cccn3-c3sc4c(c3CN2C(=O)NCc2ccc(C)cc2)CCCC4)c1 |
| InChI | InChI=1S/C31H33N3O2S/c1-3-36-24-9-6-8-23(18-24)29-27-11-7-17-33(27)30-26(25-10-4-5-12-28(25)37-30)20-34(29)31(35)32-19-22-15-13-21(2)14-16-22/h6-9,11,13-18,29H,3-5,10,12,19-20H2,1-2H3,(H,32,35) |
| InChIKey | OWCYJTGTZLYHOF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |