C29H28FN3OS — CID 92724582
(7R)-7-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92724582) has the molecular formula C29H28FN3OS and a molecular weight of 485.63 g/mol. Its IUPAC name is (7R)-7-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92724582 |
| Molecular Formula | C29H28FN3OS |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (7R)-7-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccc(CNC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H28FN3OS/c1-19-8-10-20(11-9-19)17-31-29(34)33-18-24-23-5-2-3-7-26(23)35-28(24)32-16-4-6-25(32)27(33)21-12-14-22(30)15-13-21/h4,6,8-16,27H,2-3,5,7,17-18H2,1H3,(H,31,34)/t27-/m1/s1 |
| InChIKey | RTQNOWXYSMFONR-HHHXNRCGSA-N |
| XLogP | 6.68 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |