C30H32N4OS — CID 93058742
(7R)-N-benzyl-14-ethyl-7-(4-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 93058742) has the molecular formula C30H32N4OS and a molecular weight of 496.68 g/mol. Its IUPAC name is (7R)-N-benzyl-14-ethyl-7-(4-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-N-benzyl-14-ethyl-7-(4-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 93058742 |
| Molecular Formula | C30H32N4OS |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | (7R)-N-benzyl-14-ethyl-7-(4-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCN1CCc2c(sc3c2CN(C(=O)NCc2ccccc2)[C@H](c2ccc(C)cc2)c2cccn2-3)C1 |
| InChI | InChI=1S/C30H32N4OS/c1-3-32-17-15-24-25-19-34(30(35)31-18-22-8-5-4-6-9-22)28(23-13-11-21(2)12-14-23)26-10-7-16-33(26)29(25)36-27(24)20-32/h4-14,16,28H,3,15,17-20H2,1-2H3,(H,31,35)/t28-/m1/s1 |
| InChIKey | TUNZHUPBYOLNQX-MUUNZHRXSA-N |
| XLogP | 6.04 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |