C27H23F2N3OS — CID 92749569
(7S)-N-(2-fluorophenyl)-7-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92749569) has the molecular formula C27H23F2N3OS and a molecular weight of 475.56 g/mol. Its IUPAC name is (7S)-N-(2-fluorophenyl)-7-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7S)-N-(2-fluorophenyl)-7-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92749569 |
| Molecular Formula | C27H23F2N3OS |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (7S)-N-(2-fluorophenyl)-7-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | O=C(Nc1ccccc1F)N1Cc2c(sc3c2CCCC3)-n2cccc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23F2N3OS/c28-18-13-11-17(12-14-18)25-23-9-5-15-31(23)26-20(19-6-1-4-10-24(19)34-26)16-32(25)27(33)30-22-8-3-2-7-21(22)29/h2-3,5,7-9,11-15,25H,1,4,6,10,16H2,(H,30,33)/t25-/m0/s1 |
| InChIKey | AYIVFQYDXYSCHL-VWLOTQADSA-N |
| XLogP | 6.83 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |