C29H29FN4OS — CID 46340368
7-[4-(dimethylamino)phenyl]-N-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 46340368) has the molecular formula C29H29FN4OS and a molecular weight of 500.64 g/mol. Its IUPAC name is 7-[4-(dimethylamino)phenyl]-N-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-[4-(dimethylamino)phenyl]-N-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46340368 |
| Molecular Formula | C29H29FN4OS |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 7-[4-(dimethylamino)phenyl]-N-(4-fluorophenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CN(C)c1ccc(C2c3cccn3-c3sc4c(c3CN2C(=O)Nc2ccc(F)cc2)CCCC4)cc1 |
| InChI | InChI=1S/C29H29FN4OS/c1-32(2)22-15-9-19(10-16-22)27-25-7-5-17-33(25)28-24(23-6-3-4-8-26(23)36-28)18-34(27)29(35)31-21-13-11-20(30)12-14-21/h5,7,9-17,27H,3-4,6,8,18H2,1-2H3,(H,31,35) |
| InChIKey | XNIVDVXROOEIGP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|