C31H34N4OS — CID 92873232
(7R)-7-[4-(dimethylamino)phenyl]-N-(3,4-dimethylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 92873232) has the molecular formula C31H34N4OS and a molecular weight of 510.71 g/mol. Its IUPAC name is (7R)-7-[4-(dimethylamino)phenyl]-N-(3,4-dimethylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | (7R)-7-[4-(dimethylamino)phenyl]-N-(3,4-dimethylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873232 |
| Molecular Formula | C31H34N4OS |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (7R)-7-[4-(dimethylamino)phenyl]-N-(3,4-dimethylphenyl)-17-thia-2,8-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2Cc3c(sc4c3CCCC4)-n3cccc3[C@H]2c2ccc(N(C)C)cc2)cc1C |
| InChI | InChI=1S/C31H34N4OS/c1-20-11-14-23(18-21(20)2)32-31(36)35-19-26-25-8-5-6-10-28(25)37-30(26)34-17-7-9-27(34)29(35)22-12-15-24(16-13-22)33(3)4/h7,9,11-18,29H,5-6,8,10,19H2,1-4H3,(H,32,36)/t29-/m1/s1 |
| InChIKey | IQYMMDOCKASFAC-GDLZYMKVSA-N |
| XLogP | 7.24 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|